C20H24O5 — CID 141235989
6,8,9,12-tetramethyl-2,11,13-trioxatetracyclo[12.2.2.11,4.05,10]nonadeca-5,7,9-triene-3,19-dione (PubChem CID 141235989) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 6,8,9,12-tetramethyl-2,11,13-trioxatetracyclo[12.2.2.11,4.05,10]nonadeca-5,7,9-triene-3,19-dione.
| Compound Name | 6,8,9,12-tetramethyl-2,11,13-trioxatetracyclo[12.2.2.11,4.05,10]nonadeca-5,7,9-triene-3,19-dione |
|---|---|
| PubChem CID | 141235989 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 6,8,9,12-tetramethyl-2,11,13-trioxatetracyclo[12.2.2.11,4.05,10]nonadeca-5,7,9-triene-3,19-dione |
| SMILES | Cc1cc(C)c2c(c1C)OC(C)OC1CCC3(CC1)OC(=O)C2C3=O |
| InChI | InChI=1S/C20H24O5/c1-10-9-11(2)15-16-18(21)20(25-19(16)22)7-5-14(6-8-20)23-13(4)24-17(15)12(10)3/h9,13-14,16H,5-8H2,1-4H3 |
| InChIKey | AABYWZWTGFWWOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|