C27H29ClO4 — CID 123311002
10-[3-(4-chlorophenyl)-2,4,6-trimethylphenyl]-4,12-dioxadispiro[4.2.48.25]tetradecane-9,11-dione (PubChem CID 123311002) has the molecular formula C27H29ClO4 and a molecular weight of 452.98 g/mol. Its IUPAC name is 10-[3-(4-chlorophenyl)-2,4,6-trimethylphenyl]-4,12-dioxadispiro[4.2.48.25]tetradecane-9,11-dione.
| Compound Name | 10-[3-(4-chlorophenyl)-2,4,6-trimethylphenyl]-4,12-dioxadispiro[4.2.48.25]tetradecane-9,11-dione |
|---|---|
| PubChem CID | 123311002 |
| Molecular Formula | C27H29ClO4 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 10-[3-(4-chlorophenyl)-2,4,6-trimethylphenyl]-4,12-dioxadispiro[4.2.48.25]tetradecane-9,11-dione |
| SMILES | Cc1cc(C)c(C2C(=O)OC3(CCC4(CCCO4)CC3)C2=O)c(C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H29ClO4/c1-16-15-17(2)22(18(3)21(16)19-5-7-20(28)8-6-19)23-24(29)27(32-25(23)30)12-10-26(11-13-27)9-4-14-31-26/h5-8,15,23H,4,9-14H2,1-3H3 |
| InChIKey | FUZFNAXLWMVVNQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|