C17H15BrClF3O3 — CID 91051989
3-(4-bromo-2-chloro-6-methylphenyl)-8-(trifluoromethyl)-1-oxaspiro[4.5]decane-2,4-dione (PubChem CID 91051989) has the molecular formula C17H15BrClF3O3 and a molecular weight of 439.66 g/mol. Its IUPAC name is 3-(4-bromo-2-chloro-6-methylphenyl)-8-(trifluoromethyl)-1-oxaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(4-bromo-2-chloro-6-methylphenyl)-8-(trifluoromethyl)-1-oxaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 91051989 |
| Molecular Formula | C17H15BrClF3O3 |
| Molecular Weight | 439.66 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 3-(4-bromo-2-chloro-6-methylphenyl)-8-(trifluoromethyl)-1-oxaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(Br)cc(Cl)c1C1C(=O)OC2(CCC(C(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C17H15BrClF3O3/c1-8-6-10(18)7-11(19)12(8)13-14(23)16(25-15(13)24)4-2-9(3-5-16)17(20,21)22/h6-7,9,13H,2-5H2,1H3 |
| InChIKey | VBJHVHXDKKBLAK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|