C18H22BrNO6 — CID 123318438
3-(3-bromo-2,6-dimethoxy-4-methylphenyl)-8-methoxy-1-oxa-8-azaspiro[4.5]decane-2,4-dione (PubChem CID 123318438) has the molecular formula C18H22BrNO6 and a molecular weight of 428.28 g/mol. Its IUPAC name is 3-(3-bromo-2,6-dimethoxy-4-methylphenyl)-8-methoxy-1-oxa-8-azaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-(3-bromo-2,6-dimethoxy-4-methylphenyl)-8-methoxy-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 123318438 |
| Molecular Formula | C18H22BrNO6 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-(3-bromo-2,6-dimethoxy-4-methylphenyl)-8-methoxy-1-oxa-8-azaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cc(C)c(Br)c(OC)c1C1C(=O)OC2(CCN(OC)CC2)C1=O |
| InChI | InChI=1S/C18H22BrNO6/c1-10-9-11(23-2)12(15(24-3)14(10)19)13-16(21)18(26-17(13)22)5-7-20(25-4)8-6-18/h9,13H,5-8H2,1-4H3 |
| InChIKey | SZSMVQDOGRMKSN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|