About 5H-pyrrolo[3,2-d]pyrimidin-7-ol
5H-pyrrolo[3,2-d]pyrimidin-7-ol (PubChem CID 68714083) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 5H-pyrrolo[3,2-d]pyrimidin-7-ol.
Molecular Properties
| Compound Name | 5H-pyrrolo[3,2-d]pyrimidin-7-ol |
| PubChem CID | 68714083 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 5H-pyrrolo[3,2-d]pyrimidin-7-ol |
| SMILES | Oc1c[nH]c2cncnc12 |
| InChI | InChI=1S/C6H5N3O/c10-5-2-8-4-1-7-3-9-6(4)5/h1-3,8,10H |
| InChIKey | JPIXHUXVOKRXPS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrrolo[3,2-d]pyrimidin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[3,2-d]pyrimidin-7-ol?
The IUPAC name of 5H-pyrrolo[3,2-d]pyrimidin-7-ol (CID 68714083) is 5H-pyrrolo[3,2-d]pyrimidin-7-ol.
What is the SMILES notation for 5H-pyrrolo[3,2-d]pyrimidin-7-ol?
The canonical SMILES for 5H-pyrrolo[3,2-d]pyrimidin-7-ol is Oc1c[nH]c2cncnc12.
What is the InChIKey of 5H-pyrrolo[3,2-d]pyrimidin-7-ol?
The InChIKey is JPIXHUXVOKRXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-5-2-8-4-1-7-3-9-6(4)5/h1-3,8,10H.
What are the key properties of 5H-pyrrolo[3,2-d]pyrimidin-7-ol?
5H-pyrrolo[3,2-d]pyrimidin-7-ol has a molecular weight of 135.13 g/mol, XLogP of 0.66, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[3,2-d]pyrimidin-7-ol is sourced from PubChem (CID 68714083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).