C20H14ClF3N2O6S — CID 68715026
3-[(1R)-1-(2-chlorophenyl)ethoxy]-4-[2-nitro-4-(trifluoromethoxy)anilino]thiophene-2-carboxylic acid (PubChem CID 68715026) has the molecular formula C20H14ClF3N2O6S and a molecular weight of 502.85 g/mol. Its IUPAC name is 3-[(1R)-1-(2-chlorophenyl)ethoxy]-4-[2-nitro-4-(trifluoromethoxy)anilino]thiophene-2-carboxylic acid.
| Compound Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-4-[2-nitro-4-(trifluoromethoxy)anilino]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68715026 |
| Molecular Formula | C20H14ClF3N2O6S |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 3-[(1R)-1-(2-chlorophenyl)ethoxy]-4-[2-nitro-4-(trifluoromethoxy)anilino]thiophene-2-carboxylic acid |
| SMILES | C[C@@H](Oc1c(Nc2ccc(OC(F)(F)F)cc2[N+](=O)[O-])csc1C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C20H14ClF3N2O6S/c1-10(12-4-2-3-5-13(12)21)31-17-15(9-33-18(17)19(27)28)25-14-7-6-11(32-20(22,23)24)8-16(14)26(29)30/h2-10,25H,1H3,(H,27,28)/t10-/m1/s1 |
| InChIKey | XKTFBVFPAPBOKN-SNVBAGLBSA-N |
| XLogP | 6.79 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|