C19H27Cl2N5 — CID 68719516
2,6-bis(3-butyl-1H-imidazol-3-ium-2-yl)pyridine dichloride (PubChem CID 68719516) has the molecular formula C19H27Cl2N5 and a molecular weight of 396.37 g/mol. Its IUPAC name is 2,6-bis(3-butyl-1H-imidazol-3-ium-2-yl)pyridine dichloride.
| Compound Name | 2,6-bis(3-butyl-1H-imidazol-3-ium-2-yl)pyridine dichloride |
|---|---|
| PubChem CID | 68719516 |
| Molecular Formula | C19H27Cl2N5 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 2,6-bis(3-butyl-1H-imidazol-3-ium-2-yl)pyridine dichloride |
| SMILES | CCCC[n+]1cc[nH]c1-c1cccc(-c2[nH]cc[n+]2CCCC)n1.[Cl-].[Cl-] |
| InChI | InChI=1S/C19H25N5.2ClH/c1-3-5-12-23-14-10-20-18(23)16-8-7-9-17(22-16)19-21-11-15-24(19)13-6-4-2;;/h7-11,14-15H,3-6,12-13H2,1-2H3;2*1H |
| InChIKey | DTHYACTXVYUQLD-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|