About 3,5-dimethyl-2H-pyran-2-ol
3,5-dimethyl-2H-pyran-2-ol (PubChem CID 68719754) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 3,5-dimethyl-2H-pyran-2-ol.
Molecular Properties
| Compound Name | 3,5-dimethyl-2H-pyran-2-ol |
| PubChem CID | 68719754 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3,5-dimethyl-2H-pyran-2-ol |
| SMILES | CC1=COC(O)C(C)=C1.CC1=COC(O)C(C)=C1 |
| InChI | InChI=1S/2C7H10O2/c2*1-5-3-6(2)7(8)9-4-5/h2*3-4,7-8H,1-2H3 |
| InChIKey | BVRPDBIJPVLOBL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-2H-pyran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2H-pyran-2-ol?
The IUPAC name of 3,5-dimethyl-2H-pyran-2-ol (CID 68719754) is 3,5-dimethyl-2H-pyran-2-ol.
What is the SMILES notation for 3,5-dimethyl-2H-pyran-2-ol?
The canonical SMILES for 3,5-dimethyl-2H-pyran-2-ol is CC1=COC(O)C(C)=C1.CC1=COC(O)C(C)=C1.
What is the InChIKey of 3,5-dimethyl-2H-pyran-2-ol?
The InChIKey is BVRPDBIJPVLOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10O2/c2*1-5-3-6(2)7(8)9-4-5/h2*3-4,7-8H,1-2H3.
What are the key properties of 3,5-dimethyl-2H-pyran-2-ol?
3,5-dimethyl-2H-pyran-2-ol has a molecular weight of 252.31 g/mol, XLogP of 2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2H-pyran-2-ol is sourced from PubChem (CID 68719754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).