About 6-phosphanyliminocyclohexa-1,3-dien-1-ol
6-phosphanyliminocyclohexa-1,3-dien-1-ol (PubChem CID 68719891) has the molecular formula C6H8NOP
and a molecular weight of 141.11 g/mol. Its IUPAC name is 6-phosphanyliminocyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 6-phosphanyliminocyclohexa-1,3-dien-1-ol |
| PubChem CID | 68719891 |
| Molecular Formula | C6H8NOP |
| Molecular Weight | 141.11 g/mol |
| Exact Mass | 141.03 |
| IUPAC Name | 6-phosphanyliminocyclohexa-1,3-dien-1-ol |
| SMILES | OC1=CC=CCC1=NP |
| InChI | InChI=1S/C6H8NOP/c8-6-4-2-1-3-5(6)7-9/h1-2,4,8H,3,9H2 |
| InChIKey | XDQNFGNZEQPCEH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.11 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-phosphanyliminocyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phosphanyliminocyclohexa-1,3-dien-1-ol?
The IUPAC name of 6-phosphanyliminocyclohexa-1,3-dien-1-ol (CID 68719891) is 6-phosphanyliminocyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 6-phosphanyliminocyclohexa-1,3-dien-1-ol?
The canonical SMILES for 6-phosphanyliminocyclohexa-1,3-dien-1-ol is OC1=CC=CCC1=NP.
What is the InChIKey of 6-phosphanyliminocyclohexa-1,3-dien-1-ol?
The InChIKey is XDQNFGNZEQPCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8NOP/c8-6-4-2-1-3-5(6)7-9/h1-2,4,8H,3,9H2.
What are the key properties of 6-phosphanyliminocyclohexa-1,3-dien-1-ol?
6-phosphanyliminocyclohexa-1,3-dien-1-ol has a molecular weight of 141.11 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phosphanyliminocyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 68719891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).