C7H9NO — CID 70502940
6-methyliminocyclohexa-1,3-dien-1-ol (PubChem CID 70502940) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is 6-methyliminocyclohexa-1,3-dien-1-ol.
| Compound Name | 6-methyliminocyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 70502940 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 6-methyliminocyclohexa-1,3-dien-1-ol |
| SMILES | C/N=C1\CC=CC=C1O |
| InChI | InChI=1S/C7H9NO/c1-8-6-4-2-3-5-7(6)9/h2-3,5,9H,4H2,1H3/b8-6+ |
| InChIKey | LAIAVHKLQIAYLA-SOFGYWHQSA-N |
| XLogP | 1.46 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|