About 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid
6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid (PubChem CID 70502939) has the molecular formula C7H11NO5S
and a molecular weight of 221.23 g/mol. Its IUPAC name is 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid.
Molecular Properties
| Compound Name | 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid |
| PubChem CID | 70502939 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid |
| SMILES | C/N=C1\CC=CC=C1O.O=S(=O)(O)O |
| InChI | InChI=1S/C7H9NO.H2O4S/c1-8-6-4-2-3-5-7(6)9;1-5(2,3)4/h2-3,5,9H,4H2,1H3;(H2,1,2,3,4)/b8-6+; |
| InChIKey | ACIYVQDJWJSQCX-WVLIHFOGSA-N |
| XLogP | 0.81 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid?
The IUPAC name of 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid (CID 70502939) is 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid.
What is the SMILES notation for 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid?
The canonical SMILES for 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid is C/N=C1\CC=CC=C1O.O=S(=O)(O)O.
What is the InChIKey of 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid?
The InChIKey is ACIYVQDJWJSQCX-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H9NO.H2O4S/c1-8-6-4-2-3-5-7(6)9;1-5(2,3)4/h2-3,5,9H,4H2,1H3;(H2,1,2,3,4)/b8-6+;.
What are the key properties of 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid?
6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid has a molecular weight of 221.23 g/mol, XLogP of 0.81, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyliminocyclohexa-1,3-dien-1-ol;sulfuric acid is sourced from PubChem (CID 70502939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).