C13H13NO — CID 68720148
4-ethenyl-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 68720148) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-ethenyl-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-ethenyl-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 68720148 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 4-ethenyl-2-(2-phenylethenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C=CC1COC(C=Cc2ccccc2)=N1 |
| InChI | InChI=1S/C13H13NO/c1-2-12-10-15-13(14-12)9-8-11-6-4-3-5-7-11/h2-9,12H,1,10H2 |
| InChIKey | UGOGZOFYKJEGNJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|