About tert-butyl(triphenyl)-λ4-sulfane
tert-butyl(triphenyl)-λ4-sulfane (PubChem CID 68720156) has the molecular formula C22H24S
and a molecular weight of 320.50 g/mol. Its IUPAC name is tert-butyl(triphenyl)-λ4-sulfane.
Molecular Properties
| Compound Name | tert-butyl(triphenyl)-λ4-sulfane |
| PubChem CID | 68720156 |
| Molecular Formula | C22H24S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | tert-butyl(triphenyl)-λ4-sulfane |
| SMILES | CC(C)(C)S(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24S/c1-22(2,3)23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | OASBRIVHIMJKAU-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butyl(triphenyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(triphenyl)-λ4-sulfane?
The IUPAC name of tert-butyl(triphenyl)-λ4-sulfane (CID 68720156) is tert-butyl(triphenyl)-λ4-sulfane.
What is the SMILES notation for tert-butyl(triphenyl)-λ4-sulfane?
The canonical SMILES for tert-butyl(triphenyl)-λ4-sulfane is CC(C)(C)S(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of tert-butyl(triphenyl)-λ4-sulfane?
The InChIKey is OASBRIVHIMJKAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24S/c1-22(2,3)23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-18H,1-3H3.
What are the key properties of tert-butyl(triphenyl)-λ4-sulfane?
tert-butyl(triphenyl)-λ4-sulfane has a molecular weight of 320.50 g/mol, XLogP of 6.77, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(triphenyl)-λ4-sulfane is sourced from PubChem (CID 68720156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).