C13H12N4O3 — CID 6872036
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 6872036) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6872036 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N/N=C/c2ccc3c(c2)OCO3)n[nH]1 |
| InChI | InChI=1S/C13H12N4O3/c1-8-4-10(16-15-8)13(18)17-14-6-9-2-3-11-12(5-9)20-7-19-11/h2-6H,7H2,1H3,(H,15,16)(H,17,18)/b14-6+ |
| InChIKey | CKMDDADLPPAFSD-MKMNVTDBSA-N |
| XLogP | 1.21 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|