C16H17BrN4O3 — CID 6883185
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide (PubChem CID 6883185) has the molecular formula C16H17BrN4O3 and a molecular weight of 393.24 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6883185 |
| Molecular Formula | C16H17BrN4O3 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-tert-butyl-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)(C)c1cc(C(=O)N/N=C/c2cc3c(cc2Br)OCO3)n[nH]1 |
| InChI | InChI=1S/C16H17BrN4O3/c1-16(2,3)14-6-11(19-20-14)15(22)21-18-7-9-4-12-13(5-10(9)17)24-8-23-12/h4-7H,8H2,1-3H3,(H,19,20)(H,21,22)/b18-7+ |
| InChIKey | KSWUDVHEPISKKX-CNHKJKLMSA-N |
| XLogP | 2.96 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|