C19H14BrFN4O3 — CID 4584178
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 4584178) has the molecular formula C19H14BrFN4O3 and a molecular weight of 445.25 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4584178 |
| Molecular Formula | C19H14BrFN4O3 |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Br)OCO2)c1ccn(Cc2ccccc2F)n1 |
| InChI | InChI=1S/C19H14BrFN4O3/c20-14-8-18-17(27-11-28-18)7-13(14)9-22-23-19(26)16-5-6-25(24-16)10-12-3-1-2-4-15(12)21/h1-9H,10-11H2,(H,23,26) |
| InChIKey | PDLPPGZDNCFWDB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|