C13H10BrN5O5 — CID 6873976
N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 6873976) has the molecular formula C13H10BrN5O5 and a molecular weight of 396.16 g/mol. Its IUPAC name is N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6873976 |
| Molecular Formula | C13H10BrN5O5 |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | N-[(E)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)N/N=C/c2cc3c(cc2Br)OCO3)n1 |
| InChI | InChI=1S/C13H10BrN5O5/c1-18-5-9(19(21)22)12(17-18)13(20)16-15-4-7-2-10-11(3-8(7)14)24-6-23-10/h2-5H,6H2,1H3,(H,16,20)/b15-4+ |
| InChIKey | CHLFPMYIXGMJGW-SYZQJQIISA-N |
| XLogP | 1.58 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|