C14H12Br2N4O3 — CID 1003129
4-bromo-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 1003129) has the molecular formula C14H12Br2N4O3 and a molecular weight of 444.08 g/mol. Its IUPAC name is 4-bromo-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dimethylpyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 1003129 |
| Molecular Formula | C14H12Br2N4O3 |
| Molecular Weight | 444.08 g/mol |
| Exact Mass | 441.93 |
| IUPAC Name | 4-bromo-N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NN=Cc2cc3c(cc2Br)OCO3)c1Br |
| InChI | InChI=1S/C14H12Br2N4O3/c1-7-12(16)13(20(2)19-7)14(21)18-17-5-8-3-10-11(4-9(8)15)23-6-22-10/h3-5H,6H2,1-2H3,(H,18,21) |
| InChIKey | VUMNSPCIZORHPY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.08 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|