C14H10BrN3O3 — CID 871538
N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide (PubChem CID 871538) has the molecular formula C14H10BrN3O3 and a molecular weight of 348.16 g/mol. Its IUPAC name is N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 871538 |
| Molecular Formula | C14H10BrN3O3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(NN=Cc1cc2c(cc1Br)OCO2)c1ccccn1 |
| InChI | InChI=1S/C14H10BrN3O3/c15-10-6-13-12(20-8-21-13)5-9(10)7-17-18-14(19)11-3-1-2-4-16-11/h1-7H,8H2,(H,18,19) |
| InChIKey | CLOZMIQNMSWSMT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|