C14H14N4O5 — CID 5299992
N-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-4-nitropyrazole-3-carboxamide (PubChem CID 5299992) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5299992 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-4-nitropyrazole-3-carboxamide |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H14N4O5/c1-2-17-7-10(18(20)21)13(16-17)14(19)15-6-9-3-4-11-12(5-9)23-8-22-11/h3-5,7H,2,6,8H2,1H3,(H,15,19) |
| InChIKey | FFMMGCYPPHTPAJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|