C13H11N5O6 — CID 5296155
1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-nitropyrazole-3-carboxamide (PubChem CID 5296155) has the molecular formula C13H11N5O6 and a molecular weight of 333.26 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5296155 |
| Molecular Formula | C13H11N5O6 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]-4-nitropyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)Nc2ccc3c(c2)OCO3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N5O6/c14-13(20)12-8(18(21)22)4-17(16-12)5-11(19)15-7-1-2-9-10(3-7)24-6-23-9/h1-4H,5-6H2,(H2,14,20)(H,15,19) |
| InChIKey | BNFKMWRFJZZESN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|