C14H15N5O3S — CID 978066
4-(1,3-benzodioxol-5-ylcarbamothioylamino)-1-ethylpyrazole-5-carboxamide (PubChem CID 978066) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 978066 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylcarbamothioylamino)-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(NC(=S)Nc2ccc3c(c2)OCO3)c1C(N)=O |
| InChI | InChI=1S/C14H15N5O3S/c1-2-19-12(13(15)20)9(6-16-19)18-14(23)17-8-3-4-10-11(5-8)22-7-21-10/h3-6H,2,7H2,1H3,(H2,15,20)(H2,17,18,23) |
| InChIKey | IPNXKZPQKGAOKH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|