C13H13N3O3 — CID 17126430
N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-3-carboxamide (PubChem CID 17126430) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17126430 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)Nc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H13N3O3/c1-2-16-6-5-10(15-16)13(17)14-9-3-4-11-12(7-9)19-8-18-11/h3-7H,2,8H2,1H3,(H,14,17) |
| InChIKey | BFIPFKBWQBSXAC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |