C15H19N5O4 — CID 2954124
4-[(3,4-dimethoxyphenyl)carbamoylamino]-1-ethylpyrazole-3-carboxamide (PubChem CID 2954124) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)carbamoylamino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[(3,4-dimethoxyphenyl)carbamoylamino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 2954124 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)carbamoylamino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)Nc2ccc(OC)c(OC)c2)c(C(N)=O)n1 |
| InChI | InChI=1S/C15H19N5O4/c1-4-20-8-10(13(19-20)14(16)21)18-15(22)17-9-5-6-11(23-2)12(7-9)24-3/h5-8H,4H2,1-3H3,(H2,16,21)(H2,17,18,22) |
| InChIKey | VUKIPRLOUUZGFG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |