C13H11N5O5 — CID 6873006
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide (PubChem CID 6873006) has the molecular formula C13H11N5O5 and a molecular weight of 317.26 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6873006 |
| Molecular Formula | C13H11N5O5 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-1-methyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])c(C(=O)N/N=C/c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C13H11N5O5/c1-17-6-9(18(20)21)12(16-17)13(19)15-14-5-8-2-3-10-11(4-8)23-7-22-10/h2-6H,7H2,1H3,(H,15,19)/b14-5+ |
| InChIKey | BJRCWOCTXWMQRY-LHHJGKSTSA-N |
| XLogP | 0.82 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|