C14H14N4O3 — CID 6891040
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(5-methylpyrazol-1-yl)acetamide (PubChem CID 6891040) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(5-methylpyrazol-1-yl)acetamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(5-methylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 6891040 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-(5-methylpyrazol-1-yl)acetamide |
| SMILES | Cc1ccnn1CC(=O)N/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H14N4O3/c1-10-4-5-16-18(10)8-14(19)17-15-7-11-2-3-12-13(6-11)21-9-20-12/h2-7H,8-9H2,1H3,(H,17,19)/b15-7+ |
| InChIKey | GRLBZVFSKMJVAS-VIZOYTHASA-N |
| XLogP | 1.07 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|