C14H11F3N4O3 — CID 6901535
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 6901535) has the molecular formula C14H11F3N4O3 and a molecular weight of 340.26 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 6901535 |
| Molecular Formula | C14H11F3N4O3 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)N/N=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H11F3N4O3/c15-14(16,17)12-3-4-21(20-12)7-13(22)19-18-6-9-1-2-10-11(5-9)24-8-23-10/h1-6H,7-8H2,(H,19,22)/b18-6+ |
| InChIKey | QCVIGVDAUAECMV-NGYBGAFCSA-N |
| XLogP | 1.78 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|