C22H24N4O5 — CID 4143390
1-(1-adamantyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-nitropyrazole-3-carboxamide (PubChem CID 4143390) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-(1-adamantyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4143390 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-(1-adamantyl)-N-(1,3-benzodioxol-5-ylmethyl)-4-nitropyrazole-3-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1nn(C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N4O5/c27-21(23-10-13-1-2-18-19(6-13)31-12-30-18)20-17(26(28)29)11-25(24-20)22-7-14-3-15(8-22)5-16(4-14)9-22/h1-2,6,11,14-16H,3-5,7-10,12H2,(H,23,27) |
| InChIKey | MKMLHZKDTOKKAP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 108.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|