C13H10ClN5O5 — CID 6873459
4-chloro-1-methyl-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrazole-5-carboxamide (PubChem CID 6873459) has the molecular formula C13H10ClN5O5 and a molecular weight of 351.71 g/mol. Its IUPAC name is 4-chloro-1-methyl-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrazole-5-carboxamide.
| Compound Name | 4-chloro-1-methyl-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 6873459 |
| Molecular Formula | C13H10ClN5O5 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 4-chloro-1-methyl-N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]pyrazole-5-carboxamide |
| SMILES | Cn1ncc(Cl)c1C(=O)N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C13H10ClN5O5/c1-18-12(8(14)5-16-18)13(20)17-15-4-7-2-10-11(24-6-23-10)3-9(7)19(21)22/h2-5H,6H2,1H3,(H,17,20)/b15-4+ |
| InChIKey | XQJNJQNVQBFBIR-SYZQJQIISA-N |
| XLogP | 1.47 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|