C14H10F3N5O5 — CID 2397499
N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 2397499) has the molecular formula C14H10F3N5O5 and a molecular weight of 385.26 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 2397499 |
| Molecular Formula | C14H10F3N5O5 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc(C(F)(F)F)n1)NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C14H10F3N5O5/c15-14(16,17)12-1-2-21(20-12)6-13(23)19-18-5-8-3-10-11(27-7-26-10)4-9(8)22(24)25/h1-5H,6-7H2,(H,19,23) |
| InChIKey | UKDUJQXOQXMSAV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|