C25H23F2NO2 — CID 68720645
2-[[4-(dibenzylamino)-2,6-difluorophenyl]methylidene]butanoic acid (PubChem CID 68720645) has the molecular formula C25H23F2NO2 and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[[4-(dibenzylamino)-2,6-difluorophenyl]methylidene]butanoic acid.
| Compound Name | 2-[[4-(dibenzylamino)-2,6-difluorophenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 68720645 |
| Molecular Formula | C25H23F2NO2 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[[4-(dibenzylamino)-2,6-difluorophenyl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1c(F)cc(N(Cc2ccccc2)Cc2ccccc2)cc1F)C(=O)O |
| InChI | InChI=1S/C25H23F2NO2/c1-2-20(25(29)30)13-22-23(26)14-21(15-24(22)27)28(16-18-9-5-3-6-10-18)17-19-11-7-4-8-12-19/h3-15H,2,16-17H2,1H3,(H,29,30) |
| InChIKey | YENLDZRWNYXUHC-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|