C49H36N6O — CID 163854682
2-[[4-(dibenzylamino)-2-[5-(dibenzylamino)-2-(2,2-dicyanoethenyl)benzoyl]phenyl]methylidene]propanedinitrile (PubChem CID 163854682) has the molecular formula C49H36N6O and a molecular weight of 724.87 g/mol. Its IUPAC name is 2-[[4-(dibenzylamino)-2-[5-(dibenzylamino)-2-(2,2-dicyanoethenyl)benzoyl]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(dibenzylamino)-2-[5-(dibenzylamino)-2-(2,2-dicyanoethenyl)benzoyl]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 163854682 |
| Molecular Formula | C49H36N6O |
| Molecular Weight | 724.87 g/mol |
| Exact Mass | 724.30 |
| IUPAC Name | 2-[[4-(dibenzylamino)-2-[5-(dibenzylamino)-2-(2,2-dicyanoethenyl)benzoyl]phenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(N(Cc2ccccc2)Cc2ccccc2)cc1C(=O)c1cc(N(Cc2ccccc2)Cc2ccccc2)ccc1C=C(C#N)C#N |
| InChI | InChI=1S/C49H36N6O/c50-29-41(30-51)25-43-21-23-45(54(33-37-13-5-1-6-14-37)34-38-15-7-2-8-16-38)27-47(43)49(56)48-28-46(24-22-44(48)26-42(31-52)32-53)55(35-39-17-9-3-10-18-39)36-40-19-11-4-12-20-40/h1-28H,33-36H2 |
| InChIKey | OXIDZKNRDQKVMF-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 118.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.87 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|