C25H22FN3O — CID 7911689
(E)-3-[4-[benzyl(ethyl)amino]phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 7911689) has the molecular formula C25H22FN3O and a molecular weight of 399.47 g/mol. Its IUPAC name is (E)-3-[4-[benzyl(ethyl)amino]phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-[benzyl(ethyl)amino]phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7911689 |
| Molecular Formula | C25H22FN3O |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (E)-3-[4-[benzyl(ethyl)amino]phenyl]-2-cyano-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=C(\C#N)C(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H22FN3O/c1-2-29(18-20-8-4-3-5-9-20)22-14-12-19(13-15-22)16-21(17-27)25(30)28-24-11-7-6-10-23(24)26/h3-16H,2,18H2,1H3,(H,28,30)/b21-16+ |
| InChIKey | KJBPPRZWBDTMPH-LTGZKZEYSA-N |
| XLogP | 5.40 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|