C33H30ClF3IN3O7 — CID 68721513
1-(1-iodocyclohexyl)oxycarbonyloxyethyl 3-[2-[[4-chloro-3-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]propanoate (PubChem CID 68721513) has the molecular formula C33H30ClF3IN3O7 and a molecular weight of 799.97 g/mol. Its IUPAC name is 1-(1-iodocyclohexyl)oxycarbonyloxyethyl 3-[2-[[4-chloro-3-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]propanoate.
| Compound Name | 1-(1-iodocyclohexyl)oxycarbonyloxyethyl 3-[2-[[4-chloro-3-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]propanoate |
|---|---|
| PubChem CID | 68721513 |
| Molecular Formula | C33H30ClF3IN3O7 |
| Molecular Weight | 799.97 g/mol |
| Exact Mass | 799.08 |
| IUPAC Name | 1-(1-iodocyclohexyl)oxycarbonyloxyethyl 3-[2-[[4-chloro-3-[4-cyano-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]propanoate |
| SMILES | CC(OC(=O)CCOc1ccccc1N(C)C(=O)c1ccc(Cl)c(-c2cnc(C(F)(F)F)cc2C#N)c1)OC(=O)OC1(I)CCCCC1 |
| InChI | InChI=1S/C33H30ClF3IN3O7/c1-20(47-31(44)48-32(38)13-6-3-7-14-32)46-29(42)12-15-45-27-9-5-4-8-26(27)41(2)30(43)21-10-11-25(34)23(16-21)24-19-40-28(33(35,36)37)17-22(24)18-39/h4-5,8-11,16-17,19-20H,3,6-7,12-15H2,1-2H3 |
| InChIKey | OTVNWYUJTWZAGQ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 128.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.97 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|