C27H22ClF3N2O4 — CID 68603050
4-[2-[[4-chloro-3-[4-prop-1-ynyl-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]butanoic acid (PubChem CID 68603050) has the molecular formula C27H22ClF3N2O4 and a molecular weight of 530.93 g/mol. Its IUPAC name is 4-[2-[[4-chloro-3-[4-prop-1-ynyl-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[4-chloro-3-[4-prop-1-ynyl-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 68603050 |
| Molecular Formula | C27H22ClF3N2O4 |
| Molecular Weight | 530.93 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | 4-[2-[[4-chloro-3-[4-prop-1-ynyl-6-(trifluoromethyl)-3-pyridinyl]benzoyl]-methylamino]phenoxy]butanoic acid |
| SMILES | CC#Cc1cc(C(F)(F)F)ncc1-c1cc(C(=O)N(C)c2ccccc2OCCCC(=O)O)ccc1Cl |
| InChI | InChI=1S/C27H22ClF3N2O4/c1-3-7-17-15-24(27(29,30)31)32-16-20(17)19-14-18(11-12-21(19)28)26(36)33(2)22-8-4-5-9-23(22)37-13-6-10-25(34)35/h4-5,8-9,11-12,14-16H,6,10,13H2,1-2H3,(H,34,35) |
| InChIKey | NDARGMCQJKFTCD-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|