C25H25Cl2N3O3 — CID 141327327
N-[2-(5-amino-5-oxopentoxy)phenyl]-4-chloro-3-(6-chloro-4-methyl-3-pyridinyl)-N-methylbenzamide (PubChem CID 141327327) has the molecular formula C25H25Cl2N3O3 and a molecular weight of 486.40 g/mol. Its IUPAC name is N-[2-(5-amino-5-oxopentoxy)phenyl]-4-chloro-3-(6-chloro-4-methyl-3-pyridinyl)-N-methylbenzamide.
| Compound Name | N-[2-(5-amino-5-oxopentoxy)phenyl]-4-chloro-3-(6-chloro-4-methyl-3-pyridinyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 141327327 |
| Molecular Formula | C25H25Cl2N3O3 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | N-[2-(5-amino-5-oxopentoxy)phenyl]-4-chloro-3-(6-chloro-4-methyl-3-pyridinyl)-N-methylbenzamide |
| SMILES | Cc1cc(Cl)ncc1-c1cc(C(=O)N(C)c2ccccc2OCCCCC(N)=O)ccc1Cl |
| InChI | InChI=1S/C25H25Cl2N3O3/c1-16-13-23(27)29-15-19(16)18-14-17(10-11-20(18)26)25(32)30(2)21-7-3-4-8-22(21)33-12-6-5-9-24(28)31/h3-4,7-8,10-11,13-15H,5-6,9,12H2,1-2H3,(H2,28,31) |
| InChIKey | GGAPQWOXDGPPLT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|