C27H26ClN3O4 — CID 59370373
ethyl 3-[2-[[4-chloro-3-(6-isocyano-4-methyl-3-pyridinyl)benzoyl]-methylamino]-3-methylphenoxy]propanoate (PubChem CID 59370373) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is ethyl 3-[2-[[4-chloro-3-(6-isocyano-4-methyl-3-pyridinyl)benzoyl]-methylamino]-3-methylphenoxy]propanoate.
| Compound Name | ethyl 3-[2-[[4-chloro-3-(6-isocyano-4-methyl-3-pyridinyl)benzoyl]-methylamino]-3-methylphenoxy]propanoate |
|---|---|
| PubChem CID | 59370373 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | ethyl 3-[2-[[4-chloro-3-(6-isocyano-4-methyl-3-pyridinyl)benzoyl]-methylamino]-3-methylphenoxy]propanoate |
| SMILES | [C-]#[N+]c1cc(C)c(-c2cc(C(=O)N(C)c3c(C)cccc3OCCC(=O)OCC)ccc2Cl)cn1 |
| InChI | InChI=1S/C27H26ClN3O4/c1-6-34-25(32)12-13-35-23-9-7-8-17(2)26(23)31(5)27(33)19-10-11-22(28)20(15-19)21-16-30-24(29-4)14-18(21)3/h7-11,14-16H,6,12-13H2,1-3,5H3 |
| InChIKey | RMTFEBLNSMWYNM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 73.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|