C26H22ClF3N2O3 — CID 59370340
4-chloro-3-[2-cyano-4-(trifluoromethyl)phenyl]-N-[2-(3-hydroxypropoxy)-6-methylphenyl]-N-methylbenzamide (PubChem CID 59370340) has the molecular formula C26H22ClF3N2O3 and a molecular weight of 502.92 g/mol. Its IUPAC name is 4-chloro-3-[2-cyano-4-(trifluoromethyl)phenyl]-N-[2-(3-hydroxypropoxy)-6-methylphenyl]-N-methylbenzamide.
| Compound Name | 4-chloro-3-[2-cyano-4-(trifluoromethyl)phenyl]-N-[2-(3-hydroxypropoxy)-6-methylphenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59370340 |
| Molecular Formula | C26H22ClF3N2O3 |
| Molecular Weight | 502.92 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 4-chloro-3-[2-cyano-4-(trifluoromethyl)phenyl]-N-[2-(3-hydroxypropoxy)-6-methylphenyl]-N-methylbenzamide |
| SMILES | Cc1cccc(OCCCO)c1N(C)C(=O)c1ccc(Cl)c(-c2ccc(C(F)(F)F)cc2C#N)c1 |
| InChI | InChI=1S/C26H22ClF3N2O3/c1-16-5-3-6-23(35-12-4-11-33)24(16)32(2)25(34)17-7-10-22(27)21(14-17)20-9-8-19(26(28,29)30)13-18(20)15-31/h3,5-10,13-14,33H,4,11-12H2,1-2H3 |
| InChIKey | SMLZCUVVJVIACQ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|