C22H28N2O6 — CID 70060005
ethyl 2-[3-[2-[(4-amino-3-methoxybenzoyl)-methylamino]phenoxy]propoxy]acetate (PubChem CID 70060005) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl 2-[3-[2-[(4-amino-3-methoxybenzoyl)-methylamino]phenoxy]propoxy]acetate.
| Compound Name | ethyl 2-[3-[2-[(4-amino-3-methoxybenzoyl)-methylamino]phenoxy]propoxy]acetate |
|---|---|
| PubChem CID | 70060005 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | ethyl 2-[3-[2-[(4-amino-3-methoxybenzoyl)-methylamino]phenoxy]propoxy]acetate |
| SMILES | CCOC(=O)COCCCOc1ccccc1N(C)C(=O)c1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O6/c1-4-29-21(25)15-28-12-7-13-30-19-9-6-5-8-18(19)24(2)22(26)16-10-11-17(23)20(14-16)27-3/h5-6,8-11,14H,4,7,12-13,15,23H2,1-3H3 |
| InChIKey | SMXYRVZSNJNZSF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|