C24H24N2O5 — CID 23226388
4-[[2-[(4-amino-3-methoxybenzoyl)-methylamino]-5-methylphenoxy]methyl]benzoic acid (PubChem CID 23226388) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[[2-[(4-amino-3-methoxybenzoyl)-methylamino]-5-methylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-[(4-amino-3-methoxybenzoyl)-methylamino]-5-methylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 23226388 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[[2-[(4-amino-3-methoxybenzoyl)-methylamino]-5-methylphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(C(=O)N(C)c2ccc(C)cc2OCc2ccc(C(=O)O)cc2)ccc1N |
| InChI | InChI=1S/C24H24N2O5/c1-15-4-11-20(26(2)23(27)18-9-10-19(25)21(13-18)30-3)22(12-15)31-14-16-5-7-17(8-6-16)24(28)29/h4-13H,14,25H2,1-3H3,(H,28,29) |
| InChIKey | KRDXFJBRYJCMDZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|