C27H26N4O3 — CID 172838692
2-amino-3-methoxy-N-methyl-N-[4-methyl-2-[(4-pyrimidin-2-ylphenyl)methoxy]phenyl]benzamide (PubChem CID 172838692) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-methyl-N-[4-methyl-2-[(4-pyrimidin-2-ylphenyl)methoxy]phenyl]benzamide.
| Compound Name | 2-amino-3-methoxy-N-methyl-N-[4-methyl-2-[(4-pyrimidin-2-ylphenyl)methoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 172838692 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-amino-3-methoxy-N-methyl-N-[4-methyl-2-[(4-pyrimidin-2-ylphenyl)methoxy]phenyl]benzamide |
| SMILES | COc1cccc(C(=O)N(C)c2ccc(C)cc2OCc2ccc(-c3ncccn3)cc2)c1N |
| InChI | InChI=1S/C27H26N4O3/c1-18-8-13-22(31(2)27(32)21-6-4-7-23(33-3)25(21)28)24(16-18)34-17-19-9-11-20(12-10-19)26-29-14-5-15-30-26/h4-16H,17,28H2,1-3H3 |
| InChIKey | WMRJGXXHFSBQGR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 90.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|