C31H30N4O7 — CID 18354910
2-amino-N-[2-methoxy-4-[[2-[(4-methoxyphenyl)methoxy]-4-methylphenyl]-methylcarbamoyl]phenyl]-3-nitrobenzamide (PubChem CID 18354910) has the molecular formula C31H30N4O7 and a molecular weight of 570.60 g/mol. Its IUPAC name is 2-amino-N-[2-methoxy-4-[[2-[(4-methoxyphenyl)methoxy]-4-methylphenyl]-methylcarbamoyl]phenyl]-3-nitrobenzamide.
| Compound Name | 2-amino-N-[2-methoxy-4-[[2-[(4-methoxyphenyl)methoxy]-4-methylphenyl]-methylcarbamoyl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18354910 |
| Molecular Formula | C31H30N4O7 |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 2-amino-N-[2-methoxy-4-[[2-[(4-methoxyphenyl)methoxy]-4-methylphenyl]-methylcarbamoyl]phenyl]-3-nitrobenzamide |
| SMILES | COc1ccc(COc2cc(C)ccc2N(C)C(=O)c2ccc(NC(=O)c3cccc([N+](=O)[O-])c3N)c(OC)c2)cc1 |
| InChI | InChI=1S/C31H30N4O7/c1-19-8-15-25(28(16-19)42-18-20-9-12-22(40-3)13-10-20)34(2)31(37)21-11-14-24(27(17-21)41-4)33-30(36)23-6-5-7-26(29(23)32)35(38)39/h5-17H,18,32H2,1-4H3,(H,33,36) |
| InChIKey | CYJSAZXFGBRFLK-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|