About sodium;1H-imidazole;acetate
sodium;1H-imidazole;acetate (PubChem CID 68723506) has the molecular formula C5H7N2NaO2
and a molecular weight of 150.11 g/mol. Its IUPAC name is sodium;1H-imidazole;acetate.
Molecular Properties
| Compound Name | sodium;1H-imidazole;acetate |
| PubChem CID | 68723506 |
| Molecular Formula | C5H7N2NaO2 |
| Molecular Weight | 150.11 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | sodium;1H-imidazole;acetate |
| SMILES | CC(=O)[O-].[Na+].c1c[nH]cn1 |
| InChI | InChI=1S/C3H4N2.C2H4O2.Na/c1-2-5-3-4-1;1-2(3)4;/h1-3H,(H,4,5);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | GQCLVGRUNQHONC-UHFFFAOYSA-M |
| XLogP | -3.83 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.11 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;1H-imidazole;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1H-imidazole;acetate?
The IUPAC name of sodium;1H-imidazole;acetate (CID 68723506) is sodium;1H-imidazole;acetate.
What is the SMILES notation for sodium;1H-imidazole;acetate?
The canonical SMILES for sodium;1H-imidazole;acetate is CC(=O)[O-].[Na+].c1c[nH]cn1.
What is the InChIKey of sodium;1H-imidazole;acetate?
The InChIKey is GQCLVGRUNQHONC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4N2.C2H4O2.Na/c1-2-5-3-4-1;1-2(3)4;/h1-3H,(H,4,5);1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;1H-imidazole;acetate?
sodium;1H-imidazole;acetate has a molecular weight of 150.11 g/mol, XLogP of -3.83, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1H-imidazole;acetate is sourced from PubChem (CID 68723506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).