C39H41F3N8S — CID 68724587
2-piperidin-1-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine;2-piperidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine (PubChem CID 68724587) has the molecular formula C39H41F3N8S and a molecular weight of 710.87 g/mol. Its IUPAC name is 2-piperidin-1-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine;2-piperidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine.
| Compound Name | 2-piperidin-1-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine;2-piperidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68724587 |
| Molecular Formula | C39H41F3N8S |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 710.31 |
| IUPAC Name | 2-piperidin-1-yl-N-(thiophen-2-ylmethyl)quinazolin-4-amine;2-piperidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1cccc(CNc2nc(N3CCCCC3)nc3ccccc23)c1.c1csc(CNc2nc(N3CCCCC3)nc3ccccc23)c1 |
| InChI | InChI=1S/C21H21F3N4.C18H20N4S/c22-21(23,24)16-8-6-7-15(13-16)14-25-19-17-9-2-3-10-18(17)26-20(27-19)28-11-4-1-5-12-28;1-4-10-22(11-5-1)18-20-16-9-3-2-8-15(16)17(21-18)19-13-14-7-6-12-23-14/h2-3,6-10,13H,1,4-5,11-12,14H2,(H,25,26,27);2-3,6-9,12H,1,4-5,10-11,13H2,(H,19,20,21) |
| InChIKey | CHNKPOPCRKQYLN-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |