C20H14F3N3S — CID 3235425
N-(thiophen-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine (PubChem CID 3235425) has the molecular formula C20H14F3N3S and a molecular weight of 385.41 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine.
| Compound Name | N-(thiophen-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 3235425 |
| Molecular Formula | C20H14F3N3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-2-[2-(trifluoromethyl)phenyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1ccccc1-c1nc(NCc2cccs2)c2ccccc2n1 |
| InChI | InChI=1S/C20H14F3N3S/c21-20(22,23)16-9-3-1-7-14(16)19-25-17-10-4-2-8-15(17)18(26-19)24-12-13-6-5-11-27-13/h1-11H,12H2,(H,24,25,26) |
| InChIKey | QBDAEJRHUCSSPR-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |