C17H16F3N3S — CID 5330918
N-tert-butyl-6-thiophen-3-yl-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 5330918) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is N-tert-butyl-6-thiophen-3-yl-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-tert-butyl-6-thiophen-3-yl-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 5330918 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | N-tert-butyl-6-thiophen-3-yl-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CC(C)(C)Nc1nc(C(F)(F)F)nc2ccc(-c3ccsc3)cc12 |
| InChI | InChI=1S/C17H16F3N3S/c1-16(2,3)23-14-12-8-10(11-6-7-24-9-11)4-5-13(12)21-15(22-14)17(18,19)20/h4-9H,1-3H3,(H,21,22,23) |
| InChIKey | NCYHNJRGMFRYAC-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |