C15H10F3N — CID 68724768
5-[2-(3,5-difluorophenyl)ethyl]-2-fluorobenzonitrile (PubChem CID 68724768) has the molecular formula C15H10F3N and a molecular weight of 261.25 g/mol. Its IUPAC name is 5-[2-(3,5-difluorophenyl)ethyl]-2-fluorobenzonitrile.
| Compound Name | 5-[2-(3,5-difluorophenyl)ethyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 68724768 |
| Molecular Formula | C15H10F3N |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 5-[2-(3,5-difluorophenyl)ethyl]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(CCc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/C15H10F3N/c16-13-6-11(7-14(17)8-13)2-1-10-3-4-15(18)12(5-10)9-19/h3-8H,1-2H2 |
| InChIKey | KOHYLVSYVGPUOP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |