C22H21BrN2O4S — CID 6872611
N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzenesulfonamide (PubChem CID 6872611) has the molecular formula C22H21BrN2O4S and a molecular weight of 489.39 g/mol. Its IUPAC name is N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 6872611 |
| Molecular Formula | C22H21BrN2O4S |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | N-[(E)-[4-[(4-bromophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]benzenesulfonamide |
| SMILES | CCOc1cc(/C=N/NS(=O)(=O)c2ccccc2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H21BrN2O4S/c1-2-28-22-14-18(15-24-25-30(26,27)20-6-4-3-5-7-20)10-13-21(22)29-16-17-8-11-19(23)12-9-17/h3-15,25H,2,16H2,1H3/b24-15+ |
| InChIKey | BSDQOBSPWCUBEH-BUVRLJJBSA-N |
| XLogP | 4.74 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|