C24H28N4O — CID 68727972
[1-[(3S)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]piperidin-3-yl]methanol (PubChem CID 68727972) has the molecular formula C24H28N4O and a molecular weight of 388.51 g/mol. Its IUPAC name is [1-[(3S)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[(3S)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 68727972 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [1-[(3S)-1-(4-naphthalen-2-ylpyrimidin-2-yl)pyrrolidin-3-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN([C@H]2CCN(c3nccc(-c4ccc5ccccc5c4)n3)C2)C1 |
| InChI | InChI=1S/C24H28N4O/c29-17-18-4-3-12-27(15-18)22-10-13-28(16-22)24-25-11-9-23(26-24)21-8-7-19-5-1-2-6-20(19)14-21/h1-2,5-9,11,14,18,22,29H,3-4,10,12-13,15-17H2/t18?,22-/m0/s1 |
| InChIKey | ZNCGKSXORMZUIP-YSYXNDDBSA-N |
| XLogP | 3.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |