C22H24N4 — CID 68726476
4-naphthalen-2-yl-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidine (PubChem CID 68726476) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-naphthalen-2-yl-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidine.
| Compound Name | 4-naphthalen-2-yl-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 68726476 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-naphthalen-2-yl-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)pyrimidine |
| SMILES | c1ccc2cc(-c3ccnc(N4CCC(N5CCCC5)C4)n3)ccc2c1 |
| InChI | InChI=1S/C22H24N4/c1-2-6-18-15-19(8-7-17(18)5-1)21-9-11-23-22(24-21)26-14-10-20(16-26)25-12-3-4-13-25/h1-2,5-9,11,15,20H,3-4,10,12-14,16H2 |
| InChIKey | XZFZJSHNWZPIOF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |